C13H24NO5+ — CID 142808907
[(1Z,3E)-4-ethoxycarbonylhexa-1,3-dienyl]-hydroxy-methylazanium;ethyl formate (PubChem CID 142808907) has the molecular formula C13H24NO5+ and a molecular weight of 274.34 g/mol. Its IUPAC name is [(1Z,3E)-4-ethoxycarbonylhexa-1,3-dienyl]-hydroxy-methylazanium;ethyl formate.
| Compound Name | [(1Z,3E)-4-ethoxycarbonylhexa-1,3-dienyl]-hydroxy-methylazanium;ethyl formate |
|---|---|
| PubChem CID | 142808907 |
| Molecular Formula | C13H24NO5+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(1Z,3E)-4-ethoxycarbonylhexa-1,3-dienyl]-hydroxy-methylazanium;ethyl formate |
| SMILES | CCOC(=O)/C(=C/C=C\[NH+](C)O)CC.CCOC=O |
| InChI | InChI=1S/C10H17NO3.C3H6O2/c1-4-9(10(12)14-5-2)7-6-8-11(3)13;1-2-5-3-4/h6-8,13H,4-5H2,1-3H3;3H,2H2,1H3/p+1/b8-6-,9-7+; |
| InChIKey | SEIKFWMJXYCVCQ-JYWQNNPFSA-O |
| XLogP | 0.48 |
| TPSA | 77.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|