About bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate
bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate (PubChem CID 88900920) has the molecular formula C16H27NO6
and a molecular weight of 329.39 g/mol. Its IUPAC name is bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate.
Molecular Properties
| Compound Name | bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate |
| PubChem CID | 88900920 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate |
| SMILES | CN(C)/C=C/C=C(C(=O)OCCCCO)C(=O)OCCCCO |
| InChI | InChI=1S/C16H27NO6/c1-17(2)9-7-8-14(15(20)22-12-5-3-10-18)16(21)23-13-6-4-11-19/h7-9,18-19H,3-6,10-13H2,1-2H3/b9-7+ |
| InChIKey | RDNYRIJWPWMQCE-VQHVLOKHSA-N |
| XLogP | 0.62 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate?
The IUPAC name of bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate (CID 88900920) is bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate.
What is the SMILES notation for bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate?
The canonical SMILES for bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate is CN(C)/C=C/C=C(C(=O)OCCCCO)C(=O)OCCCCO.
What is the InChIKey of bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate?
The InChIKey is RDNYRIJWPWMQCE-VQHVLOKHSA-N. The full InChI is InChI=1S/C16H27NO6/c1-17(2)9-7-8-14(15(20)22-12-5-3-10-18)16(21)23-13-6-4-11-19/h7-9,18-19H,3-6,10-13H2,1-2H3/b9-7+.
What are the key properties of bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate?
bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate has a molecular weight of 329.39 g/mol, XLogP of 0.62, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-hydroxybutyl) 2-[(E)-3-(dimethylamino)prop-2-enylidene]propanedioate is sourced from PubChem (CID 88900920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).