C12H18N2O2 — CID 88900556
butyl (2Z,4E)-2-cyano-5-(dimethylamino)penta-2,4-dienoate (PubChem CID 88900556) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is butyl (2Z,4E)-2-cyano-5-(dimethylamino)penta-2,4-dienoate.
| Compound Name | butyl (2Z,4E)-2-cyano-5-(dimethylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 88900556 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | butyl (2Z,4E)-2-cyano-5-(dimethylamino)penta-2,4-dienoate |
| SMILES | CCCCOC(=O)/C(C#N)=C\C=C\N(C)C |
| InChI | InChI=1S/C12H18N2O2/c1-4-5-9-16-12(15)11(10-13)7-6-8-14(2)3/h6-8H,4-5,9H2,1-3H3/b8-6+,11-7- |
| InChIKey | PZLBYFZRUZVNEZ-VJUDZZRDSA-N |
| XLogP | 1.85 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|