C22H34N4O6 — CID 88900938
3-[(2E,4E)-2-amino-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoyl]oxypropyl (2E,4E)-2-cyano-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoate (PubChem CID 88900938) has the molecular formula C22H34N4O6 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-[(2E,4E)-2-amino-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoyl]oxypropyl (2E,4E)-2-cyano-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoate.
| Compound Name | 3-[(2E,4E)-2-amino-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoyl]oxypropyl (2E,4E)-2-cyano-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoate |
|---|---|
| PubChem CID | 88900938 |
| Molecular Formula | C22H34N4O6 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 3-[(2E,4E)-2-amino-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoyl]oxypropyl (2E,4E)-2-cyano-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoate |
| SMILES | CCN(/C=C/C=C(/N)C(=O)OCCCOC(=O)/C(C#N)=C/C=C/N(CC)CCO)CCO |
| InChI | InChI=1S/C22H34N4O6/c1-3-25(12-14-27)10-5-8-19(18-23)21(29)31-16-7-17-32-22(30)20(24)9-6-11-26(4-2)13-15-28/h5-6,8-11,27-28H,3-4,7,12-17,24H2,1-2H3/b10-5+,11-6+,19-8+,20-9+ |
| InChIKey | PHJUOSMIOLWZGE-XHPNNJLLSA-N |
| XLogP | 0.41 |
| TPSA | 149.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|