C23H34N4O8 — CID 123976901
3-[5-[bis(2-hydroxyethyl)amino]-2-cyano-1-hydroxypenta-2,4-dienoxy]propyl 5-[bis(2-hydroxyethyl)amino]-2-cyanopenta-2,4-dienoate (PubChem CID 123976901) has the molecular formula C23H34N4O8 and a molecular weight of 494.55 g/mol. Its IUPAC name is 3-[5-[bis(2-hydroxyethyl)amino]-2-cyano-1-hydroxypenta-2,4-dienoxy]propyl 5-[bis(2-hydroxyethyl)amino]-2-cyanopenta-2,4-dienoate.
| Compound Name | 3-[5-[bis(2-hydroxyethyl)amino]-2-cyano-1-hydroxypenta-2,4-dienoxy]propyl 5-[bis(2-hydroxyethyl)amino]-2-cyanopenta-2,4-dienoate |
|---|---|
| PubChem CID | 123976901 |
| Molecular Formula | C23H34N4O8 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 3-[5-[bis(2-hydroxyethyl)amino]-2-cyano-1-hydroxypenta-2,4-dienoxy]propyl 5-[bis(2-hydroxyethyl)amino]-2-cyanopenta-2,4-dienoate |
| SMILES | N#CC(=CC=CN(CCO)CCO)C(=O)OCCCOC(O)C(C#N)=CC=CN(CCO)CCO |
| InChI | InChI=1S/C23H34N4O8/c24-18-20(4-1-6-26(8-12-28)9-13-29)22(32)34-16-3-17-35-23(33)21(19-25)5-2-7-27(10-14-30)11-15-31/h1-2,4-7,22,28-32H,3,8-17H2 |
| InChIKey | FITQAKJHVDUDON-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 190.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|