C17H26N2O4 — CID 138528763
(2-methyl-1,3-dioxolan-4-yl)methyl (2E,4E)-2-cyano-5-(dipropylamino)penta-2,4-dienoate (PubChem CID 138528763) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2-methyl-1,3-dioxolan-4-yl)methyl (2E,4E)-2-cyano-5-(dipropylamino)penta-2,4-dienoate.
| Compound Name | (2-methyl-1,3-dioxolan-4-yl)methyl (2E,4E)-2-cyano-5-(dipropylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 138528763 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (2-methyl-1,3-dioxolan-4-yl)methyl (2E,4E)-2-cyano-5-(dipropylamino)penta-2,4-dienoate |
| SMILES | CCCN(/C=C/C=C(\C#N)C(=O)OCC1COC(C)O1)CCC |
| InChI | InChI=1S/C17H26N2O4/c1-4-8-19(9-5-2)10-6-7-15(11-18)17(20)22-13-16-12-21-14(3)23-16/h6-7,10,14,16H,4-5,8-9,12-13H2,1-3H3/b10-6+,15-7+ |
| InChIKey | OYYAHKBMFBTOMN-NNGXMHFZSA-N |
| XLogP | 2.38 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|