C20H34N2O2 — CID 88900526
ethyl (2Z,4E)-2-cyano-5-(dihexylamino)penta-2,4-dienoate (PubChem CID 88900526) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is ethyl (2Z,4E)-2-cyano-5-(dihexylamino)penta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-2-cyano-5-(dihexylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 88900526 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | ethyl (2Z,4E)-2-cyano-5-(dihexylamino)penta-2,4-dienoate |
| SMILES | CCCCCCN(/C=C/C=C(/C#N)C(=O)OCC)CCCCCC |
| InChI | InChI=1S/C20H34N2O2/c1-4-7-9-11-15-22(16-12-10-8-5-2)17-13-14-19(18-21)20(23)24-6-3/h13-14,17H,4-12,15-16H2,1-3H3/b17-13+,19-14- |
| InChIKey | WFMFJCJEVHTFCT-KGLWARJVSA-N |
| XLogP | 4.98 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|