C18H32N2 — CID 58559705
(2Z,4E)-5-(dihexylamino)-2-methylpenta-2,4-dienenitrile (PubChem CID 58559705) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is (2Z,4E)-5-(dihexylamino)-2-methylpenta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-5-(dihexylamino)-2-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 58559705 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | (2Z,4E)-5-(dihexylamino)-2-methylpenta-2,4-dienenitrile |
| SMILES | CCCCCCN(/C=C/C=C(/C)C#N)CCCCCC |
| InChI | InChI=1S/C18H32N2/c1-4-6-8-10-14-20(15-11-9-7-5-2)16-12-13-18(3)17-19/h12-13,16H,4-11,14-15H2,1-3H3/b16-12+,18-13- |
| InChIKey | NLDRCZXNKYYSGH-GPWQLRHTSA-N |
| XLogP | 5.43 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|