C22H38N2O4 — CID 146177728
(2Z,4E)-5-[butyl(pentyl)amino]-2-[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-hydroxyethyl]penta-2,4-dienenitrile (PubChem CID 146177728) has the molecular formula C22H38N2O4 and a molecular weight of 394.56 g/mol. Its IUPAC name is (2Z,4E)-5-[butyl(pentyl)amino]-2-[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-hydroxyethyl]penta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-5-[butyl(pentyl)amino]-2-[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-hydroxyethyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 146177728 |
| Molecular Formula | C22H38N2O4 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | (2Z,4E)-5-[butyl(pentyl)amino]-2-[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-hydroxyethyl]penta-2,4-dienenitrile |
| SMILES | CCCCCN(/C=C/C=C(\C#N)CC(O)OCC1COC(C)(C)O1)CCCC |
| InChI | InChI=1S/C22H38N2O4/c1-5-7-9-13-24(12-8-6-2)14-10-11-19(16-23)15-21(25)26-17-20-18-27-22(3,4)28-20/h10-11,14,20-21,25H,5-9,12-13,15,17-18H2,1-4H3/b14-10+,19-11- |
| InChIKey | LWBLTYHOQSAINS-YPJQUURKSA-N |
| XLogP | 4.12 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|