C17H30N2O4 — CID 89394860
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl (2Z,4E)-2-amino-5-(dipropylamino)penta-2,4-dienoate (PubChem CID 89394860) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl (2Z,4E)-2-amino-5-(dipropylamino)penta-2,4-dienoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl (2Z,4E)-2-amino-5-(dipropylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 89394860 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl (2Z,4E)-2-amino-5-(dipropylamino)penta-2,4-dienoate |
| SMILES | CCCN(/C=C/C=C(\N)C(=O)OCC1COC(C)(C)O1)CCC |
| InChI | InChI=1S/C17H30N2O4/c1-5-9-19(10-6-2)11-7-8-15(18)16(20)21-12-14-13-22-17(3,4)23-14/h7-8,11,14H,5-6,9-10,12-13,18H2,1-4H3/b11-7+,15-8- |
| InChIKey | XJEZPEQDOKCYOS-WOJXAIDLSA-N |
| XLogP | 2.16 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|