C32H50N4O4 — CID 76628912
4-[5-(dibutylamino)-2-isocyanopenta-2,4-dienoyl]oxybutyl 2-cyano-5-(dibutylamino)penta-2,4-dienoate (PubChem CID 76628912) has the molecular formula C32H50N4O4 and a molecular weight of 554.78 g/mol. Its IUPAC name is 4-[5-(dibutylamino)-2-isocyanopenta-2,4-dienoyl]oxybutyl 2-cyano-5-(dibutylamino)penta-2,4-dienoate.
| Compound Name | 4-[5-(dibutylamino)-2-isocyanopenta-2,4-dienoyl]oxybutyl 2-cyano-5-(dibutylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 76628912 |
| Molecular Formula | C32H50N4O4 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.38 |
| IUPAC Name | 4-[5-(dibutylamino)-2-isocyanopenta-2,4-dienoyl]oxybutyl 2-cyano-5-(dibutylamino)penta-2,4-dienoate |
| SMILES | [C-]#[N+]C(=CC=CN(CCCC)CCCC)C(=O)OCCCCOC(=O)C(C#N)=CC=CN(CCCC)CCCC |
| InChI | InChI=1S/C32H50N4O4/c1-6-10-20-35(21-11-7-2)24-16-18-29(28-33)31(37)39-26-14-15-27-40-32(38)30(34-5)19-17-25-36(22-12-8-3)23-13-9-4/h16-19,24-25H,6-15,20-23,26-27H2,1-4H3 |
| InChIKey | LSXTXDMUWVYPPO-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|