C19H30N2O2 — CID 88900524
octyl (2Z,4E)-2-cyano-5-piperidin-1-ylpenta-2,4-dienoate (PubChem CID 88900524) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is octyl (2Z,4E)-2-cyano-5-piperidin-1-ylpenta-2,4-dienoate.
| Compound Name | octyl (2Z,4E)-2-cyano-5-piperidin-1-ylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 88900524 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | octyl (2Z,4E)-2-cyano-5-piperidin-1-ylpenta-2,4-dienoate |
| SMILES | CCCCCCCCOC(=O)/C(C#N)=C\C=C\N1CCCCC1 |
| InChI | InChI=1S/C19H30N2O2/c1-2-3-4-5-6-10-16-23-19(22)18(17-20)12-11-15-21-13-8-7-9-14-21/h11-12,15H,2-10,13-14,16H2,1H3/b15-11+,18-12- |
| InChIKey | CZQYYZKUEVYDAQ-YGPCBGHTSA-N |
| XLogP | 4.34 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|