C22H28N4O4 — CID 123940361
propan-2-yl 2-cyano-5-[4-(4-cyano-5-oxo-5-propan-2-yloxypenta-1,3-dienyl)piperazin-1-yl]penta-2,4-dienoate (PubChem CID 123940361) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is propan-2-yl 2-cyano-5-[4-(4-cyano-5-oxo-5-propan-2-yloxypenta-1,3-dienyl)piperazin-1-yl]penta-2,4-dienoate.
| Compound Name | propan-2-yl 2-cyano-5-[4-(4-cyano-5-oxo-5-propan-2-yloxypenta-1,3-dienyl)piperazin-1-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 123940361 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | propan-2-yl 2-cyano-5-[4-(4-cyano-5-oxo-5-propan-2-yloxypenta-1,3-dienyl)piperazin-1-yl]penta-2,4-dienoate |
| SMILES | CC(C)OC(=O)C(C#N)=CC=CN1CCN(C=CC=C(C#N)C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C22H28N4O4/c1-17(2)29-21(27)19(15-23)7-5-9-25-11-13-26(14-12-25)10-6-8-20(16-24)22(28)30-18(3)4/h5-10,17-18H,11-14H2,1-4H3 |
| InChIKey | JBBVOYUNDRMUPE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 106.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|