C32H50N4O4 — CID 123960082
2-ethylhexyl 2-cyano-5-[4-[4-cyano-5-(2-ethylhexoxy)-5-hydroxypenta-1,3-dienyl]piperazin-1-yl]penta-2,4-dienoate (PubChem CID 123960082) has the molecular formula C32H50N4O4 and a molecular weight of 554.78 g/mol. Its IUPAC name is 2-ethylhexyl 2-cyano-5-[4-[4-cyano-5-(2-ethylhexoxy)-5-hydroxypenta-1,3-dienyl]piperazin-1-yl]penta-2,4-dienoate.
| Compound Name | 2-ethylhexyl 2-cyano-5-[4-[4-cyano-5-(2-ethylhexoxy)-5-hydroxypenta-1,3-dienyl]piperazin-1-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 123960082 |
| Molecular Formula | C32H50N4O4 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.38 |
| IUPAC Name | 2-ethylhexyl 2-cyano-5-[4-[4-cyano-5-(2-ethylhexoxy)-5-hydroxypenta-1,3-dienyl]piperazin-1-yl]penta-2,4-dienoate |
| SMILES | CCCCC(CC)COC(=O)C(C#N)=CC=CN1CCN(C=CC=C(C#N)C(O)OCC(CC)CCCC)CC1 |
| InChI | InChI=1S/C32H50N4O4/c1-5-9-13-27(7-3)25-39-31(37)29(23-33)15-11-17-35-19-21-36(22-20-35)18-12-16-30(24-34)32(38)40-26-28(8-4)14-10-6-2/h11-12,15-18,27-28,31,37H,5-10,13-14,19-22,25-26H2,1-4H3 |
| InChIKey | PHKCLMGEPSWPCU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|