C15H23NO2 — CID 142849721
2-ethylhexyl (2E,4E)-2-cyanohexa-2,4-dienoate (PubChem CID 142849721) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-ethylhexyl (2E,4E)-2-cyanohexa-2,4-dienoate.
| Compound Name | 2-ethylhexyl (2E,4E)-2-cyanohexa-2,4-dienoate |
|---|---|
| PubChem CID | 142849721 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-ethylhexyl (2E,4E)-2-cyanohexa-2,4-dienoate |
| SMILES | C/C=C/C=C(\C#N)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C15H23NO2/c1-4-7-9-13(6-3)12-18-15(17)14(11-16)10-8-5-2/h5,8,10,13H,4,6-7,9,12H2,1-3H3/b8-5+,14-10+ |
| InChIKey | CDZRQFFREBKOCA-HNTZWPLZSA-N |
| XLogP | 3.77 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|