C38H42N4O4S3 — CID 132515964
2-ethylhexyl (E)-2-cyano-3-[5-[4-[5-[(E)-2-cyano-3-(2-ethylhexoxy)-3-oxoprop-1-enyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]thiophen-2-yl]prop-2-enoate (PubChem CID 132515964) has the molecular formula C38H42N4O4S3 and a molecular weight of 714.98 g/mol. Its IUPAC name is 2-ethylhexyl (E)-2-cyano-3-[5-[4-[5-[(E)-2-cyano-3-(2-ethylhexoxy)-3-oxoprop-1-enyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]thiophen-2-yl]prop-2-enoate.
| Compound Name | 2-ethylhexyl (E)-2-cyano-3-[5-[4-[5-[(E)-2-cyano-3-(2-ethylhexoxy)-3-oxoprop-1-enyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]thiophen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 132515964 |
| Molecular Formula | C38H42N4O4S3 |
| Molecular Weight | 714.98 g/mol |
| Exact Mass | 714.24 |
| IUPAC Name | 2-ethylhexyl (E)-2-cyano-3-[5-[4-[5-[(E)-2-cyano-3-(2-ethylhexoxy)-3-oxoprop-1-enyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]thiophen-2-yl]prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)/C(C#N)=C/c1ccc(-c2ccc(-c3ccc(/C=C(\C#N)C(=O)OCC(CC)CCCC)s3)c3nsnc23)s1 |
| InChI | InChI=1S/C38H42N4O4S3/c1-5-9-11-25(7-3)23-45-37(43)27(21-39)19-29-13-17-33(47-29)31-15-16-32(36-35(31)41-49-42-36)34-18-14-30(48-34)20-28(22-40)38(44)46-24-26(8-4)12-10-6-2/h13-20,25-26H,5-12,23-24H2,1-4H3/b27-19+,28-20+ |
| InChIKey | MFKRNNYJLJPBAU-MKYUKRCKSA-N |
| XLogP | 10.48 |
| TPSA | 125.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.98 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|