C30H41NO4S — CID 90269061
(Z)-2-cyano-3-[5-(2,4-dioctoxyphenyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 90269061) has the molecular formula C30H41NO4S and a molecular weight of 511.73 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-(2,4-dioctoxyphenyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[5-(2,4-dioctoxyphenyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90269061 |
| Molecular Formula | C30H41NO4S |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | (Z)-2-cyano-3-[5-(2,4-dioctoxyphenyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(/C=C(/C#N)C(=O)O)s2)c(OCCCCCCCC)c1 |
| InChI | InChI=1S/C30H41NO4S/c1-3-5-7-9-11-13-19-34-25-15-17-27(28(22-25)35-20-14-12-10-8-6-4-2)29-18-16-26(36-29)21-24(23-31)30(32)33/h15-18,21-22H,3-14,19-20H2,1-2H3,(H,32,33)/b24-21- |
| InChIKey | NCVWPVFFKSUUGF-FLFQWRMESA-N |
| XLogP | 8.89 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|