C19H24O3S — CID 86726979
5-(2,4-dibutoxyphenyl)thiophene-2-carbaldehyde (PubChem CID 86726979) has the molecular formula C19H24O3S and a molecular weight of 332.47 g/mol. Its IUPAC name is 5-(2,4-dibutoxyphenyl)thiophene-2-carbaldehyde.
| Compound Name | 5-(2,4-dibutoxyphenyl)thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 86726979 |
| Molecular Formula | C19H24O3S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 5-(2,4-dibutoxyphenyl)thiophene-2-carbaldehyde |
| SMILES | CCCCOc1ccc(-c2ccc(C=O)s2)c(OCCCC)c1 |
| InChI | InChI=1S/C19H24O3S/c1-3-5-11-21-15-7-9-17(18(13-15)22-12-6-4-2)19-10-8-16(14-20)23-19/h7-10,13-14H,3-6,11-12H2,1-2H3 |
| InChIKey | WCKXWKKGIATFIE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|