C32H34N2O3S — CID 102528085
(E)-2-cyano-3-[10-ethyl-7-(4-octoxyphenyl)phenothiazin-3-yl]prop-2-enoic acid (PubChem CID 102528085) has the molecular formula C32H34N2O3S and a molecular weight of 526.70 g/mol. Its IUPAC name is (E)-2-cyano-3-[10-ethyl-7-(4-octoxyphenyl)phenothiazin-3-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[10-ethyl-7-(4-octoxyphenyl)phenothiazin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102528085 |
| Molecular Formula | C32H34N2O3S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (E)-2-cyano-3-[10-ethyl-7-(4-octoxyphenyl)phenothiazin-3-yl]prop-2-enoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccc3c(c2)Sc2cc(/C=C(\C#N)C(=O)O)ccc2N3CC)cc1 |
| InChI | InChI=1S/C32H34N2O3S/c1-3-5-6-7-8-9-18-37-27-14-11-24(12-15-27)25-13-17-29-31(21-25)38-30-20-23(19-26(22-33)32(35)36)10-16-28(30)34(29)4-2/h10-17,19-21H,3-9,18H2,1-2H3,(H,35,36)/b26-19+ |
| InChIKey | RIKCGLHFZJHDHF-LGUFXXKBSA-N |
| XLogP | 8.71 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|