C44H43FN2O3S2 — CID 142740086
(E)-2-cyano-3-[2-fluoro-4-[5-[7-(4-hexoxyphenyl)-10-hexylphenothiazin-3-yl]thiophen-2-yl]phenyl]prop-2-enoic acid (PubChem CID 142740086) has the molecular formula C44H43FN2O3S2 and a molecular weight of 730.97 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-fluoro-4-[5-[7-(4-hexoxyphenyl)-10-hexylphenothiazin-3-yl]thiophen-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[2-fluoro-4-[5-[7-(4-hexoxyphenyl)-10-hexylphenothiazin-3-yl]thiophen-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142740086 |
| Molecular Formula | C44H43FN2O3S2 |
| Molecular Weight | 730.97 g/mol |
| Exact Mass | 730.27 |
| IUPAC Name | (E)-2-cyano-3-[2-fluoro-4-[5-[7-(4-hexoxyphenyl)-10-hexylphenothiazin-3-yl]thiophen-2-yl]phenyl]prop-2-enoic acid |
| SMILES | CCCCCCOc1ccc(-c2ccc3c(c2)Sc2cc(-c4ccc(-c5ccc(/C=C(\C#N)C(=O)O)c(F)c5)s4)ccc2N3CCCCCC)cc1 |
| InChI | InChI=1S/C44H43FN2O3S2/c1-3-5-7-9-23-47-38-19-15-31(30-13-17-36(18-14-30)50-24-10-8-6-4-2)27-42(38)52-43-28-34(16-20-39(43)47)41-22-21-40(51-41)33-12-11-32(37(45)26-33)25-35(29-46)44(48)49/h11-22,25-28H,3-10,23-24H2,1-2H3,(H,48,49)/b35-25+ |
| InChIKey | INJSXQVPEHQLAC-KVQDIILNSA-N |
| XLogP | 13.02 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.97 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|