About (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid
(Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid (PubChem CID 177410720) has the molecular formula C38H46N2O5
and a molecular weight of 610.79 g/mol. Its IUPAC name is (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid |
| PubChem CID | 177410720 |
| Molecular Formula | C38H46N2O5 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid |
| SMILES | CCCCCCCCN1c2ccc(/C=C(/C#N)C(=O)O)cc2Oc2cc(-c3ccc(OCCCC)cc3OCCCC)ccc21 |
| InChI | InChI=1S/C38H46N2O5/c1-4-7-10-11-12-13-20-40-33-18-14-28(23-30(27-39)38(41)42)24-36(33)45-37-25-29(15-19-34(37)40)32-17-16-31(43-21-8-5-2)26-35(32)44-22-9-6-3/h14-19,23-26H,4-13,20-22H2,1-3H3,(H,41,42)/b30-23- |
| InChIKey | GNPXGBXZZYPWKR-WMMMYUQOSA-N |
| XLogP | 10.31 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid?
The IUPAC name of (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid (CID 177410720) is (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid.
What is the SMILES notation for (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid?
The canonical SMILES for (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid is CCCCCCCCN1c2ccc(/C=C(/C#N)C(=O)O)cc2Oc2cc(-c3ccc(OCCCC)cc3OCCCC)ccc21.
What is the InChIKey of (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid?
The InChIKey is GNPXGBXZZYPWKR-WMMMYUQOSA-N. The full InChI is InChI=1S/C38H46N2O5/c1-4-7-10-11-12-13-20-40-33-18-14-28(23-30(27-39)38(41)42)24-36(33)45-37-25-29(15-19-34(37)40)32-17-16-31(43-21-8-5-2)26-35(32)44-22-9-6-3/h14-19,23-26H,4-13,20-22H2,1-3H3,(H,41,42)/b30-23-.
What are the key properties of (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid?
(Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid has a molecular weight of 610.79 g/mol, XLogP of 10.31, 18 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-cyano-3-[7-(2,4-dibutoxyphenyl)-10-octylphenoxazin-3-yl]prop-2-enoic acid is sourced from PubChem (CID 177410720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).