C62H62N4O4S — CID 177412634
(Z)-3-[5-[2,3-bis(4-octoxyphenyl)-8-[4-(N-phenylanilino)phenyl]quinoxalin-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 177412634) has the molecular formula C62H62N4O4S and a molecular weight of 959.27 g/mol. Its IUPAC name is (Z)-3-[5-[2,3-bis(4-octoxyphenyl)-8-[4-(N-phenylanilino)phenyl]quinoxalin-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[2,3-bis(4-octoxyphenyl)-8-[4-(N-phenylanilino)phenyl]quinoxalin-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 177412634 |
| Molecular Formula | C62H62N4O4S |
| Molecular Weight | 959.27 g/mol |
| Exact Mass | 958.45 |
| IUPAC Name | (Z)-3-[5-[2,3-bis(4-octoxyphenyl)-8-[4-(N-phenylanilino)phenyl]quinoxalin-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2nc3c(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc(-c4ccc(/C=C(/C#N)C(=O)O)s4)c3nc2-c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C62H62N4O4S/c1-3-5-7-9-11-19-41-69-52-33-27-46(28-34-52)58-59(47-29-35-53(36-30-47)70-42-20-12-10-8-6-4-2)65-61-56(57-40-37-54(71-57)43-48(44-63)62(67)68)39-38-55(60(61)64-58)45-25-31-51(32-26-45)66(49-21-15-13-16-22-49)50-23-17-14-18-24-50/h13-18,21-40,43H,3-12,19-20,41-42H2,1-2H3,(H,67,68)/b48-43- |
| InChIKey | MCKVZGCJRORBCT-HKTXRNFJSA-N |
| XLogP | 17.30 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.27 |
| LogP ≤ 5 | 17.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|