C55H56N4O4S2 — CID 102487754
(E)-2-cyano-3-[5-[7-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]-5,6-dihexoxy-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 102487754) has the molecular formula C55H56N4O4S2 and a molecular weight of 901.21 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[7-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]-5,6-dihexoxy-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[7-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]-5,6-dihexoxy-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102487754 |
| Molecular Formula | C55H56N4O4S2 |
| Molecular Weight | 901.21 g/mol |
| Exact Mass | 900.37 |
| IUPAC Name | (E)-2-cyano-3-[5-[7-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]-5,6-dihexoxy-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCOc1c(OCCCCCC)c(-c2ccc(/C=C(\C#N)C(=O)O)s2)c2nsnc2c1-c1ccc2c(c1)C(CC)(CC)c1cc(N(c3ccccc3)c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C55H56N4O4S2/c1-5-9-11-19-31-62-52-48(50-51(58-65-57-50)49(53(52)63-32-20-12-10-6-2)47-30-27-42(64-47)33-38(36-56)54(60)61)37-25-28-43-44-29-26-41(35-46(44)55(7-3,8-4)45(43)34-37)59(39-21-15-13-16-22-39)40-23-17-14-18-24-40/h13-18,21-30,33-35H,5-12,19-20,31-32H2,1-4H3,(H,60,61)/b38-33+ |
| InChIKey | PZGRVFUCCHWKKW-NNIBMBRCSA-N |
| XLogP | 15.55 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.21 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|