C47H42N4O3S — CID 142735240
2-cyano-3-[5-[3-(4-hexoxyphenyl)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 142735240) has the molecular formula C47H42N4O3S and a molecular weight of 742.95 g/mol. Its IUPAC name is 2-cyano-3-[5-[3-(4-hexoxyphenyl)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[5-[3-(4-hexoxyphenyl)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142735240 |
| Molecular Formula | C47H42N4O3S |
| Molecular Weight | 742.95 g/mol |
| Exact Mass | 742.30 |
| IUPAC Name | 2-cyano-3-[5-[3-(4-hexoxyphenyl)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCOc1ccc(C2CC(c3ccc(C=C(C#N)C(=O)O)s3)=NN2c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C47H42N4O3S/c1-2-3-4-11-30-54-42-26-20-36(21-27-42)45-32-44(46-29-28-43(55-46)31-37(33-48)47(52)53)49-51(45)41-24-18-35(19-25-41)34-16-22-40(23-17-34)50(38-12-7-5-8-13-38)39-14-9-6-10-15-39/h5-10,12-29,31,45H,2-4,11,30,32H2,1H3,(H,52,53) |
| InChIKey | SURHUQVONNFPMJ-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.95 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|