C37H36N4O4S — CID 144963380
(E)-2-cyano-3-[5-[2-[4-[4-ethenyl-5-[(Z)-prop-1-enyl]-1,3-oxazol-2-yl]phenyl]-3-(4-hexoxyphenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 144963380) has the molecular formula C37H36N4O4S and a molecular weight of 632.79 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[2-[4-[4-ethenyl-5-[(Z)-prop-1-enyl]-1,3-oxazol-2-yl]phenyl]-3-(4-hexoxyphenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[2-[4-[4-ethenyl-5-[(Z)-prop-1-enyl]-1,3-oxazol-2-yl]phenyl]-3-(4-hexoxyphenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 144963380 |
| Molecular Formula | C37H36N4O4S |
| Molecular Weight | 632.79 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | (E)-2-cyano-3-[5-[2-[4-[4-ethenyl-5-[(Z)-prop-1-enyl]-1,3-oxazol-2-yl]phenyl]-3-(4-hexoxyphenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | C=Cc1nc(-c2ccc(N3N=C(c4ccc(/C=C(\C#N)C(=O)O)s4)CC3c3ccc(OCCCCCC)cc3)cc2)oc1/C=C\C |
| InChI | InChI=1S/C37H36N4O4S/c1-4-7-8-9-21-44-29-17-13-25(14-18-29)33-23-32(35-20-19-30(46-35)22-27(24-38)37(42)43)40-41(33)28-15-11-26(12-16-28)36-39-31(6-3)34(45-36)10-5-2/h5-6,10-20,22,33H,3-4,7-9,21,23H2,1-2H3,(H,42,43)/b10-5-,27-22+ |
| InChIKey | QAIFXDWFCJHKRZ-KGERKGRWSA-N |
| XLogP | 9.39 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.79 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|