C44H31N5O5 — CID 118530794
(E)-3-[5-[2-[4-[2-[4-[5-(1H-benzimidazol-2-yl)furan-2-yl]phenyl]-3-(4-ethoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]ethynyl]furan-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 118530794) has the molecular formula C44H31N5O5 and a molecular weight of 709.76 g/mol. Its IUPAC name is (E)-3-[5-[2-[4-[2-[4-[5-(1H-benzimidazol-2-yl)furan-2-yl]phenyl]-3-(4-ethoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]ethynyl]furan-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[5-[2-[4-[2-[4-[5-(1H-benzimidazol-2-yl)furan-2-yl]phenyl]-3-(4-ethoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]ethynyl]furan-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 118530794 |
| Molecular Formula | C44H31N5O5 |
| Molecular Weight | 709.76 g/mol |
| Exact Mass | 709.23 |
| IUPAC Name | (E)-3-[5-[2-[4-[2-[4-[5-(1H-benzimidazol-2-yl)furan-2-yl]phenyl]-3-(4-ethoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]ethynyl]furan-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CCOc1ccc(C2CC(c3ccc(C#Cc4ccc(/C=C(\C#N)C(=O)O)o4)cc3)=NN2c2ccc(-c3ccc(-c4nc5ccccc5[nH]4)o3)cc2)cc1 |
| InChI | InChI=1S/C44H31N5O5/c1-2-52-34-19-14-30(15-20-34)40-26-39(29-10-7-28(8-11-29)9-18-35-21-22-36(53-35)25-32(27-45)44(50)51)48-49(40)33-16-12-31(13-17-33)41-23-24-42(54-41)43-46-37-5-3-4-6-38(37)47-43/h3-8,10-17,19-25,40H,2,26H2,1H3,(H,46,47)(H,50,51)/b32-25+ |
| InChIKey | XOBHKRPNLDPVRK-WGPBWIAQSA-N |
| XLogP | 9.23 |
| TPSA | 140.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.76 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|