C31H19N5O3S — CID 118530795
(E)-3-[5-[2-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(4-cyanophenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 118530795) has the molecular formula C31H19N5O3S and a molecular weight of 541.59 g/mol. Its IUPAC name is (E)-3-[5-[2-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(4-cyanophenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[5-[2-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(4-cyanophenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 118530795 |
| Molecular Formula | C31H19N5O3S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | (E)-3-[5-[2-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(4-cyanophenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(C2=NN(c3ccc(-c4nc5ccccc5o4)cc3)C(c3ccc(C#N)cc3)C2)s1)C(=O)O |
| InChI | InChI=1S/C31H19N5O3S/c32-17-19-5-7-20(8-6-19)27-16-26(29-14-13-24(40-29)15-22(18-33)31(37)38)35-36(27)23-11-9-21(10-12-23)30-34-25-3-1-2-4-28(25)39-30/h1-15,27H,16H2,(H,37,38)/b22-15+ |
| InChIKey | ZYSJBQXDMJFSKL-PXLXIMEGSA-N |
| XLogP | 6.78 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|