C32H22N2O4S2 — CID 102592658
(E)-2-cyano-3-[5-[7-[4-(N-phenylanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 102592658) has the molecular formula C32H22N2O4S2 and a molecular weight of 562.67 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[7-[4-(N-phenylanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[7-[4-(N-phenylanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102592658 |
| Molecular Formula | C32H22N2O4S2 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | (E)-2-cyano-3-[5-[7-[4-(N-phenylanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2sc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c3c2OCCO3)s1)C(=O)O |
| InChI | InChI=1S/C32H22N2O4S2/c33-20-22(32(35)36)19-26-15-16-27(39-26)31-29-28(37-17-18-38-29)30(40-31)21-11-13-25(14-12-21)34(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-16,19H,17-18H2,(H,35,36)/b22-19+ |
| InChIKey | APNCZPUAEUEXGS-ZBJSNUHESA-N |
| XLogP | 8.38 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|