C38H26N2O2S — CID 132594191
(E)-2-cyano-3-[5-[4-[4-[4-(N-phenylanilino)phenyl]phenyl]phenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 132594191) has the molecular formula C38H26N2O2S and a molecular weight of 574.71 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[4-[4-[4-(N-phenylanilino)phenyl]phenyl]phenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[4-[4-[4-(N-phenylanilino)phenyl]phenyl]phenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 132594191 |
| Molecular Formula | C38H26N2O2S |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | (E)-2-cyano-3-[5-[4-[4-[4-(N-phenylanilino)phenyl]phenyl]phenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)cc2)s1)C(=O)O |
| InChI | InChI=1S/C38H26N2O2S/c39-26-32(38(41)42)25-36-23-24-37(43-36)31-17-15-29(16-18-31)27-11-13-28(14-12-27)30-19-21-35(22-20-30)40(33-7-3-1-4-8-33)34-9-5-2-6-10-34/h1-25H,(H,41,42)/b32-25+ |
| InChIKey | JDBLYHYMHRONQI-WGPBWIAQSA-N |
| XLogP | 10.21 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|