C36H21F2N5O2S2 — CID 139260615
(E)-2-cyano-3-[5-[5,6-difluoro-7-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-2H-benzotriazol-4-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 139260615) has the molecular formula C36H21F2N5O2S2 and a molecular weight of 657.73 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[5,6-difluoro-7-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-2H-benzotriazol-4-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[5,6-difluoro-7-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-2H-benzotriazol-4-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139260615 |
| Molecular Formula | C36H21F2N5O2S2 |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 657.11 |
| IUPAC Name | (E)-2-cyano-3-[5-[5,6-difluoro-7-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-2H-benzotriazol-4-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2c(F)c(F)c(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)s3)c3n[nH]nc23)s1)C(=O)O |
| InChI | InChI=1S/C36H21F2N5O2S2/c37-32-30(28-16-15-26(46-28)19-22(20-39)36(44)45)34-35(41-42-40-34)31(33(32)38)29-18-17-27(47-29)21-11-13-25(14-12-21)43(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-19H,(H,44,45)(H,40,41,42)/b22-19+ |
| InChIKey | DKGMQTKXZYQDFZ-ZBJSNUHESA-N |
| XLogP | 9.82 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|