C53H41N3O2S2 — CID 139256010
(E)-2-cyano-3-[5-[5-[4-(N-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 139256010) has the molecular formula C53H41N3O2S2 and a molecular weight of 816.06 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[5-[4-(N-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[5-[4-(N-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139256010 |
| Molecular Formula | C53H41N3O2S2 |
| Molecular Weight | 816.06 g/mol |
| Exact Mass | 815.26 |
| IUPAC Name | (E)-2-cyano-3-[5-[5-[4-(N-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCC1(CC)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2ccc(N(c3ccccc3)c3ccc(-c4ccc(-c5ccc(/C=C(\C#N)C(=O)O)s5)s4)cc3)cc21 |
| InChI | InChI=1S/C53H41N3O2S2/c1-3-53(4-2)47-33-42(55(38-14-8-5-9-15-38)39-16-10-6-11-17-39)24-27-45(47)46-28-25-43(34-48(46)53)56(40-18-12-7-13-19-40)41-22-20-36(21-23-41)49-30-31-51(60-49)50-29-26-44(59-50)32-37(35-54)52(57)58/h5-34H,3-4H2,1-2H3,(H,57,58)/b37-32+ |
| InChIKey | ZAFYNKROWKOJKM-BQNXFWFHSA-N |
| XLogP | 15.16 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.06 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|