C46H37N3O2S2 — CID 70988880
(E)-2-cyano-3-[5-[5-[5-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]thiophen-2-yl]-1-methylpyrrol-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 70988880) has the molecular formula C46H37N3O2S2 and a molecular weight of 727.96 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[5-[5-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]thiophen-2-yl]-1-methylpyrrol-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[5-[5-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]thiophen-2-yl]-1-methylpyrrol-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70988880 |
| Molecular Formula | C46H37N3O2S2 |
| Molecular Weight | 727.96 g/mol |
| Exact Mass | 727.23 |
| IUPAC Name | (E)-2-cyano-3-[5-[5-[5-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]thiophen-2-yl]-1-methylpyrrol-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCC1(CC)c2cc(-c3ccc(-c4ccc(-c5ccc(/C=C(\C#N)C(=O)O)s5)n4C)s3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C46H37N3O2S2/c1-4-46(5-2)38-27-30(42-24-25-44(53-42)41-22-21-40(48(41)3)43-23-18-35(52-43)26-31(29-47)45(50)51)16-19-36(38)37-20-17-34(28-39(37)46)49(32-12-8-6-9-13-32)33-14-10-7-11-15-33/h6-28H,4-5H2,1-3H3,(H,50,51)/b31-26+ |
| InChIKey | UGWQBJIUYCJUJI-GKPLWNPISA-N |
| XLogP | 12.70 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.96 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|