C42H35N3O2S — CID 76608055
3-[5-[5-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]-1-methylpyrrol-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 76608055) has the molecular formula C42H35N3O2S and a molecular weight of 645.83 g/mol. Its IUPAC name is 3-[5-[5-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]-1-methylpyrrol-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | 3-[5-[5-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]-1-methylpyrrol-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 76608055 |
| Molecular Formula | C42H35N3O2S |
| Molecular Weight | 645.83 g/mol |
| Exact Mass | 645.24 |
| IUPAC Name | 3-[5-[5-[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]-1-methylpyrrol-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]C(=Cc1ccc(-c2ccc(-c3ccc4c(c3)C(CC)(CC)c3cc(N(c5ccccc5)c5ccccc5)ccc3-4)n2C)s1)C(=O)O |
| InChI | InChI=1S/C42H35N3O2S/c1-5-42(6-2)35-25-28(38-22-23-39(44(38)4)40-24-19-32(48-40)27-37(43-3)41(46)47)17-20-33(35)34-21-18-31(26-36(34)42)45(29-13-9-7-10-14-29)30-15-11-8-12-16-30/h7-27H,5-6H2,1-2,4H3,(H,46,47) |
| InChIKey | PWEJISCPFPCUBS-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.83 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|