C34H26N2O2S2 — CID 159600266
(Z)-3-[7,7-dimethyl-10-[4-(N-(4-methylphenyl)anilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 159600266) has the molecular formula C34H26N2O2S2 and a molecular weight of 558.73 g/mol. Its IUPAC name is (Z)-3-[7,7-dimethyl-10-[4-(N-(4-methylphenyl)anilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[7,7-dimethyl-10-[4-(N-(4-methylphenyl)anilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 159600266 |
| Molecular Formula | C34H26N2O2S2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | (Z)-3-[7,7-dimethyl-10-[4-(N-(4-methylphenyl)anilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1cc2c(s1)-c1sc(-c3ccc(N(c4ccccc4)c4ccc(C)cc4)cc3)cc1C2(C)C)C(=O)O |
| InChI | InChI=1S/C34H26N2O2S2/c1-21-10-14-24(15-11-21)36(23-8-6-5-7-9-23)25-16-12-22(13-17-25)30-20-28-32(40-30)31-27(34(28,2)3)18-26(39-31)19-29(35-4)33(37)38/h5-20H,1-3H3,(H,37,38)/b29-19- |
| InChIKey | AXUHTYARIAYKRL-CEUNXORHSA-N |
| XLogP | 9.91 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|