C26H18N2O3 — CID 59561541
(Z)-2-isocyano-3-[5-[4-(N-phenylanilino)phenyl]furan-2-yl]prop-2-enoic acid (PubChem CID 59561541) has the molecular formula C26H18N2O3 and a molecular weight of 406.44 g/mol. Its IUPAC name is (Z)-2-isocyano-3-[5-[4-(N-phenylanilino)phenyl]furan-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-isocyano-3-[5-[4-(N-phenylanilino)phenyl]furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59561541 |
| Molecular Formula | C26H18N2O3 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (Z)-2-isocyano-3-[5-[4-(N-phenylanilino)phenyl]furan-2-yl]prop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1ccc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)o1)C(=O)O |
| InChI | InChI=1S/C26H18N2O3/c1-27-24(26(29)30)18-23-16-17-25(31-23)19-12-14-22(15-13-19)28(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-18H,(H,29,30)/b24-18- |
| InChIKey | KCBYLTHTRZOOKM-MOHJPFBDSA-N |
| XLogP | 6.76 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|