C37H28N2O2 — CID 59762714
(E)-3-[4-(N-[4-(2,2-diphenylethenyl)phenyl]-4-methylanilino)phenyl]-2-isocyanoprop-2-enoic acid (PubChem CID 59762714) has the molecular formula C37H28N2O2 and a molecular weight of 532.64 g/mol. Its IUPAC name is (E)-3-[4-(N-[4-(2,2-diphenylethenyl)phenyl]-4-methylanilino)phenyl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-(N-[4-(2,2-diphenylethenyl)phenyl]-4-methylanilino)phenyl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 59762714 |
| Molecular Formula | C37H28N2O2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (E)-3-[4-(N-[4-(2,2-diphenylethenyl)phenyl]-4-methylanilino)phenyl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C/c1ccc(N(c2ccc(C)cc2)c2ccc(C=C(c3ccccc3)c3ccccc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C37H28N2O2/c1-27-13-19-32(20-14-27)39(34-23-17-29(18-24-34)26-36(38-2)37(40)41)33-21-15-28(16-22-33)25-35(30-9-5-3-6-10-30)31-11-7-4-8-12-31/h3-26H,1H3,(H,40,41)/b36-26+ |
| InChIKey | ZABGJGFOJICNNE-LZBRRTOVSA-N |
| XLogP | 9.40 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|