C24H18N2O2 — CID 58675785
(2Z,4E)-2-isocyano-5-[4-(N-phenylanilino)phenyl]penta-2,4-dienoic acid (PubChem CID 58675785) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is (2Z,4E)-2-isocyano-5-[4-(N-phenylanilino)phenyl]penta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-2-isocyano-5-[4-(N-phenylanilino)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 58675785 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (2Z,4E)-2-isocyano-5-[4-(N-phenylanilino)phenyl]penta-2,4-dienoic acid |
| SMILES | [C-]#[N+]/C(=C\C=C\c1ccc(N(c2ccccc2)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C24H18N2O2/c1-25-23(24(27)28)14-8-9-19-15-17-22(18-16-19)26(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-18H,(H,27,28)/b9-8+,23-14- |
| InChIKey | QHRUYUYRJWYVAU-IKBJVLILSA-N |
| XLogP | 6.06 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|