C52H58N2O2 — CID 58660268
(2Z,4E)-2-isocyano-5-[4-[4-(4-octan-2-ylphenyl)-N-[4-(4-octan-2-ylphenyl)phenyl]anilino]phenyl]penta-2,4-dienoic acid (PubChem CID 58660268) has the molecular formula C52H58N2O2 and a molecular weight of 743.05 g/mol. Its IUPAC name is (2Z,4E)-2-isocyano-5-[4-[4-(4-octan-2-ylphenyl)-N-[4-(4-octan-2-ylphenyl)phenyl]anilino]phenyl]penta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-2-isocyano-5-[4-[4-(4-octan-2-ylphenyl)-N-[4-(4-octan-2-ylphenyl)phenyl]anilino]phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 58660268 |
| Molecular Formula | C52H58N2O2 |
| Molecular Weight | 743.05 g/mol |
| Exact Mass | 742.45 |
| IUPAC Name | (2Z,4E)-2-isocyano-5-[4-[4-(4-octan-2-ylphenyl)-N-[4-(4-octan-2-ylphenyl)phenyl]anilino]phenyl]penta-2,4-dienoic acid |
| SMILES | [C-]#[N+]/C(=C\C=C\c1ccc(N(c2ccc(-c3ccc(C(C)CCCCCC)cc3)cc2)c2ccc(-c3ccc(C(C)CCCCCC)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C52H58N2O2/c1-6-8-10-12-15-39(3)42-21-25-44(26-22-42)46-29-35-49(36-30-46)54(48-33-19-41(20-34-48)17-14-18-51(53-5)52(55)56)50-37-31-47(32-38-50)45-27-23-43(24-28-45)40(4)16-13-11-9-7-2/h14,17-40H,6-13,15-16H2,1-4H3,(H,55,56)/b17-14+,51-18- |
| InChIKey | SUDACPBUGYBFFU-BFSHTRIHSA-N |
| XLogP | 15.54 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.05 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|