C52H58N2O2 — CID 88857612
(2E,4E)-2-cyano-5-[4-[4-(4-octylphenyl)-N-[4-(4-octylphenyl)phenyl]anilino]phenyl]penta-2,4-dienoic acid (PubChem CID 88857612) has the molecular formula C52H58N2O2 and a molecular weight of 743.05 g/mol. Its IUPAC name is (2E,4E)-2-cyano-5-[4-[4-(4-octylphenyl)-N-[4-(4-octylphenyl)phenyl]anilino]phenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-cyano-5-[4-[4-(4-octylphenyl)-N-[4-(4-octylphenyl)phenyl]anilino]phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 88857612 |
| Molecular Formula | C52H58N2O2 |
| Molecular Weight | 743.05 g/mol |
| Exact Mass | 742.45 |
| IUPAC Name | (2E,4E)-2-cyano-5-[4-[4-(4-octylphenyl)-N-[4-(4-octylphenyl)phenyl]anilino]phenyl]penta-2,4-dienoic acid |
| SMILES | CCCCCCCCc1ccc(-c2ccc(N(c3ccc(/C=C/C=C(\C#N)C(=O)O)cc3)c3ccc(-c4ccc(CCCCCCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C52H58N2O2/c1-3-5-7-9-11-13-16-41-20-26-44(27-21-41)46-30-36-50(37-31-46)54(49-34-24-43(25-35-49)18-15-19-48(40-53)52(55)56)51-38-32-47(33-39-51)45-28-22-42(23-29-45)17-14-12-10-8-6-4-2/h15,18-39H,3-14,16-17H2,1-2H3,(H,55,56)/b18-15+,48-19+ |
| InChIKey | MOCCHQVZIQXHFZ-DDPVQZLMSA-N |
| XLogP | 14.84 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.05 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|