C26H28N2O2 — CID 91260674
2-cyano-5-[1-(4-hexylphenyl)-2,3-dihydroindol-5-yl]penta-2,4-dienoic acid (PubChem CID 91260674) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-cyano-5-[1-(4-hexylphenyl)-2,3-dihydroindol-5-yl]penta-2,4-dienoic acid.
| Compound Name | 2-cyano-5-[1-(4-hexylphenyl)-2,3-dihydroindol-5-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91260674 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-cyano-5-[1-(4-hexylphenyl)-2,3-dihydroindol-5-yl]penta-2,4-dienoic acid |
| SMILES | CCCCCCc1ccc(N2CCc3cc(C=CC=C(C#N)C(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C26H28N2O2/c1-2-3-4-5-7-20-10-13-24(14-11-20)28-17-16-22-18-21(12-15-25(22)28)8-6-9-23(19-27)26(29)30/h6,8-15,18H,2-5,7,16-17H2,1H3,(H,29,30) |
| InChIKey | DCEGUQYOCAPRQW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|