C32H31N3O4 — CID 149308030
(2Z,4E)-5-[3-[(1E,3Z)-4-carboxy-4-cyanobuta-1,3-dienyl]-11-hexyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl]-2-cyanopenta-2,4-dienoic acid (PubChem CID 149308030) has the molecular formula C32H31N3O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is (2Z,4E)-5-[3-[(1E,3Z)-4-carboxy-4-cyanobuta-1,3-dienyl]-11-hexyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl]-2-cyanopenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[3-[(1E,3Z)-4-carboxy-4-cyanobuta-1,3-dienyl]-11-hexyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl]-2-cyanopenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 149308030 |
| Molecular Formula | C32H31N3O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (2Z,4E)-5-[3-[(1E,3Z)-4-carboxy-4-cyanobuta-1,3-dienyl]-11-hexyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl]-2-cyanopenta-2,4-dienoic acid |
| SMILES | CCCCCCN1c2ccc(/C=C/C=C(/C#N)C(=O)O)cc2CCc2cc(/C=C/C=C(/C#N)C(=O)O)ccc21 |
| InChI | InChI=1S/C32H31N3O4/c1-2-3-4-5-18-35-29-16-12-23(8-6-10-27(21-33)31(36)37)19-25(29)14-15-26-20-24(13-17-30(26)35)9-7-11-28(22-34)32(38)39/h6-13,16-17,19-20H,2-5,14-15,18H2,1H3,(H,36,37)(H,38,39)/b8-6+,9-7+,27-10-,28-11- |
| InChIKey | XYBGVTSOFITJCZ-HZQCBJJKSA-N |
| XLogP | 6.60 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|