C22H20N2O2 — CID 90278288
[(1Z,3E)-1-cyano-4-(11-ethyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)buta-1,3-dienyl] formate (PubChem CID 90278288) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is [(1Z,3E)-1-cyano-4-(11-ethyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)buta-1,3-dienyl] formate.
| Compound Name | [(1Z,3E)-1-cyano-4-(11-ethyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)buta-1,3-dienyl] formate |
|---|---|
| PubChem CID | 90278288 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [(1Z,3E)-1-cyano-4-(11-ethyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)buta-1,3-dienyl] formate |
| SMILES | CCN1c2ccccc2CCc2cc(/C=C/C=C(/C#N)OC=O)ccc21 |
| InChI | InChI=1S/C22H20N2O2/c1-2-24-21-9-4-3-7-18(21)11-12-19-14-17(10-13-22(19)24)6-5-8-20(15-23)26-16-25/h3-10,13-14,16H,2,11-12H2,1H3/b6-5+,20-8- |
| InChIKey | QWHXAHDWGYWXOB-HVIUWHAGSA-N |
| XLogP | 4.54 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|