C34H24N2O2S2 — CID 76780653
2-cyano-3-[3-(11-ethyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)-[1]benzothiolo[3,2-b][1]benzothiol-8-yl]prop-2-enoic acid (PubChem CID 76780653) has the molecular formula C34H24N2O2S2 and a molecular weight of 556.71 g/mol. Its IUPAC name is 2-cyano-3-[3-(11-ethyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)-[1]benzothiolo[3,2-b][1]benzothiol-8-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[3-(11-ethyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)-[1]benzothiolo[3,2-b][1]benzothiol-8-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76780653 |
| Molecular Formula | C34H24N2O2S2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 2-cyano-3-[3-(11-ethyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)-[1]benzothiolo[3,2-b][1]benzothiol-8-yl]prop-2-enoic acid |
| SMILES | CCN1c2ccccc2CCc2cc(-c3ccc4sc5c6cc(C=C(C#N)C(=O)O)ccc6sc5c4c3)ccc21 |
| InChI | InChI=1S/C34H24N2O2S2/c1-2-36-28-6-4-3-5-21(28)8-9-24-17-22(10-12-29(24)36)23-11-14-31-27(18-23)33-32(40-31)26-16-20(7-13-30(26)39-33)15-25(19-35)34(37)38/h3-7,10-18H,2,8-9H2,1H3,(H,37,38) |
| InChIKey | YVQFJEXQCCCBHG-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|