C31H23N3O2 — CID 91395337
3-[1-(4-carbazol-9-ylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-2-cyanoprop-2-enoic acid (PubChem CID 91395337) has the molecular formula C31H23N3O2 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-[1-(4-carbazol-9-ylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | 3-[1-(4-carbazol-9-ylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 91395337 |
| Molecular Formula | C31H23N3O2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 3-[1-(4-carbazol-9-ylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-2-cyanoprop-2-enoic acid |
| SMILES | N#CC(=Cc1ccc2c(c1)CCCN2c1ccc(-n2c3ccccc3c3ccccc32)cc1)C(=O)O |
| InChI | InChI=1S/C31H23N3O2/c32-20-23(31(35)36)19-21-11-16-28-22(18-21)6-5-17-33(28)24-12-14-25(15-13-24)34-29-9-3-1-7-26(29)27-8-2-4-10-30(27)34/h1-4,7-16,18-19H,5-6,17H2,(H,35,36) |
| InChIKey | PPRYBTCBCHYQON-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|