C35H28N3O2+ — CID 77439746
1-methyl-6-[2-[1-(9-phenylcarbazol-3-yl)-2,3-dihydroindol-5-yl]ethenyl]pyridin-1-ium-3-carboxylic acid (PubChem CID 77439746) has the molecular formula C35H28N3O2+ and a molecular weight of 522.63 g/mol. Its IUPAC name is 1-methyl-6-[2-[1-(9-phenylcarbazol-3-yl)-2,3-dihydroindol-5-yl]ethenyl]pyridin-1-ium-3-carboxylic acid.
| Compound Name | 1-methyl-6-[2-[1-(9-phenylcarbazol-3-yl)-2,3-dihydroindol-5-yl]ethenyl]pyridin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 77439746 |
| Molecular Formula | C35H28N3O2+ |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 1-methyl-6-[2-[1-(9-phenylcarbazol-3-yl)-2,3-dihydroindol-5-yl]ethenyl]pyridin-1-ium-3-carboxylic acid |
| SMILES | C[n+]1cc(C(=O)O)ccc1C=Cc1ccc2c(c1)CCN2c1ccc2c(c1)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C35H27N3O2/c1-36-23-26(35(39)40)13-15-27(36)14-11-24-12-17-32-25(21-24)19-20-37(32)29-16-18-34-31(22-29)30-9-5-6-10-33(30)38(34)28-7-3-2-4-8-28/h2-18,21-23H,19-20H2,1H3/p+1 |
| InChIKey | GASRFDPSAWSKLH-UHFFFAOYSA-O |
| XLogP | 7.17 |
| TPSA | 49.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|