C24H21NO2 — CID 101353795
methyl 4-[5-[(E)-2-phenylethenyl]-2,3-dihydroindol-1-yl]benzoate (PubChem CID 101353795) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is methyl 4-[5-[(E)-2-phenylethenyl]-2,3-dihydroindol-1-yl]benzoate.
| Compound Name | methyl 4-[5-[(E)-2-phenylethenyl]-2,3-dihydroindol-1-yl]benzoate |
|---|---|
| PubChem CID | 101353795 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | methyl 4-[5-[(E)-2-phenylethenyl]-2,3-dihydroindol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCc3cc(/C=C/c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C24H21NO2/c1-27-24(26)20-10-12-22(13-11-20)25-16-15-21-17-19(9-14-23(21)25)8-7-18-5-3-2-4-6-18/h2-14,17H,15-16H2,1H3/b8-7+ |
| InChIKey | CIEWIAZQWHNBNJ-BQYQJAHWSA-N |
| XLogP | 5.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|