C16H17N3O2 — CID 151533413
1-hydroxy-3-methyl-1-(1-phenyl-2,3-dihydroindol-5-yl)urea (PubChem CID 151533413) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-hydroxy-3-methyl-1-(1-phenyl-2,3-dihydroindol-5-yl)urea.
| Compound Name | 1-hydroxy-3-methyl-1-(1-phenyl-2,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 151533413 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-hydroxy-3-methyl-1-(1-phenyl-2,3-dihydroindol-5-yl)urea |
| SMILES | CNC(=O)N(O)c1ccc2c(c1)CCN2c1ccccc1 |
| InChI | InChI=1S/C16H17N3O2/c1-17-16(20)19(21)14-7-8-15-12(11-14)9-10-18(15)13-5-3-2-4-6-13/h2-8,11,21H,9-10H2,1H3,(H,17,20) |
| InChIKey | PWYLWUMYHRFHTI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|