C21H24N2O3 — CID 66891736
tert-butyl 5-[benzoyl(methyl)amino]-2,3-dihydroindole-1-carboxylate (PubChem CID 66891736) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is tert-butyl 5-[benzoyl(methyl)amino]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-[benzoyl(methyl)amino]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 66891736 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | tert-butyl 5-[benzoyl(methyl)amino]-2,3-dihydroindole-1-carboxylate |
| SMILES | CN(C(=O)c1ccccc1)c1ccc2c(c1)CCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H24N2O3/c1-21(2,3)26-20(25)23-13-12-16-14-17(10-11-18(16)23)22(4)19(24)15-8-6-5-7-9-15/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | JKMXUCFFFPZAFR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |