C26H27NO3 — CID 58020909
tert-butyl 5-(4-phenylmethoxyphenyl)-2,3-dihydroindole-1-carboxylate (PubChem CID 58020909) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is tert-butyl 5-(4-phenylmethoxyphenyl)-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-(4-phenylmethoxyphenyl)-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 58020909 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | tert-butyl 5-(4-phenylmethoxyphenyl)-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(-c3ccc(OCc4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C26H27NO3/c1-26(2,3)30-25(28)27-16-15-22-17-21(11-14-24(22)27)20-9-12-23(13-10-20)29-18-19-7-5-4-6-8-19/h4-14,17H,15-16,18H2,1-3H3 |
| InChIKey | ILMBIWVOGWVJBB-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |