C19H22N2O3 — CID 86723941
tert-butyl 6-benzyl-5-oxo-2,3-dihydropyrrolo[2,3-c]pyridine-1-carboxylate (PubChem CID 86723941) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is tert-butyl 6-benzyl-5-oxo-2,3-dihydropyrrolo[2,3-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-benzyl-5-oxo-2,3-dihydropyrrolo[2,3-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 86723941 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | tert-butyl 6-benzyl-5-oxo-2,3-dihydropyrrolo[2,3-c]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(=O)n(Cc3ccccc3)cc21 |
| InChI | InChI=1S/C19H22N2O3/c1-19(2,3)24-18(23)21-10-9-15-11-17(22)20(13-16(15)21)12-14-7-5-4-6-8-14/h4-8,11,13H,9-10,12H2,1-3H3 |
| InChIKey | RVTGIRNOBAQGBU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|